C7H10N2S — CID 98157930
(3aS)-2,3a,4,5,6,7-hexahydroindazole-3-thione (PubChem CID 98157930) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is (3aS)-2,3a,4,5,6,7-hexahydroindazole-3-thione.
| Compound Name | (3aS)-2,3a,4,5,6,7-hexahydroindazole-3-thione |
|---|---|
| PubChem CID | 98157930 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (3aS)-2,3a,4,5,6,7-hexahydroindazole-3-thione |
| SMILES | S=C1NN=C2CCCC[C@H]12 |
| InChI | InChI=1S/C7H10N2S/c10-7-5-3-1-2-4-6(5)8-9-7/h5H,1-4H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | OJOLMCYIXJLEEM-YFKPBYRVSA-N |
| XLogP | 1.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|