About (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine
(2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine (PubChem CID 98159704) has the molecular formula C35H33N2P
and a molecular weight of 512.64 g/mol. Its IUPAC name is (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine.
Molecular Properties
| Compound Name | (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine |
| PubChem CID | 98159704 |
| Molecular Formula | C35H33N2P |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine |
| SMILES | CC([C@@H](C)NN=C(c1ccccc1)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H33N2P/c1-28(36-37-35(30-18-8-3-9-19-30)31-20-10-4-11-21-31)29(2)38(32-22-12-5-13-23-32,33-24-14-6-15-25-33)34-26-16-7-17-27-34/h3-28,36H,1-2H3/t28-/m1/s1 |
| InChIKey | NNYPRCOPFARHNB-MUUNZHRXSA-N |
| XLogP | 6.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine?
The IUPAC name of (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine (CID 98159704) is (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine.
What is the SMILES notation for (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine?
The canonical SMILES for (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine is CC([C@@H](C)NN=C(c1ccccc1)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine?
The InChIKey is NNYPRCOPFARHNB-MUUNZHRXSA-N. The full InChI is InChI=1S/C35H33N2P/c1-28(36-37-35(30-18-8-3-9-19-30)31-20-10-4-11-21-31)29(2)38(32-22-12-5-13-23-32,33-24-14-6-15-25-33)34-26-16-7-17-27-34/h3-28,36H,1-2H3/t28-/m1/s1.
What are the key properties of (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine?
(2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine has a molecular weight of 512.64 g/mol, XLogP of 6.60, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(benzhydrylideneamino)-3-(triphenyl-λ5-phosphanylidene)butan-2-amine is sourced from PubChem (CID 98159704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).