C7H11ClO2S — CID 98163053
(1R,2R,5R)-2-chloro-8λ6-thiabicyclo[3.2.1]octane 8,8-dioxide (PubChem CID 98163053) has the molecular formula C7H11ClO2S and a molecular weight of 194.68 g/mol. Its IUPAC name is (1R,2R,5R)-2-chloro-8λ6-thiabicyclo[3.2.1]octane 8,8-dioxide.
| Compound Name | (1R,2R,5R)-2-chloro-8λ6-thiabicyclo[3.2.1]octane 8,8-dioxide |
|---|---|
| PubChem CID | 98163053 |
| Molecular Formula | C7H11ClO2S |
| Molecular Weight | 194.68 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (1R,2R,5R)-2-chloro-8λ6-thiabicyclo[3.2.1]octane 8,8-dioxide |
| SMILES | O=S1(=O)[C@H]2CC[C@@H](Cl)[C@H]1CC2 |
| InChI | InChI=1S/C7H11ClO2S/c8-6-3-1-5-2-4-7(6)11(5,9)10/h5-7H,1-4H2/t5-,6+,7+/m0/s1 |
| InChIKey | PMVKRBVCQBJWPT-RRKCRQDMSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|