C18H26N2O2S — CID 98299925
N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-propylbenzenesulfonamide (PubChem CID 98299925) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-propylbenzenesulfonamide.
| Compound Name | N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 98299925 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)N/N=C(/C)[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C18H26N2O2S/c1-3-4-14-6-9-17(10-7-14)23(21,22)20-19-13(2)18-12-15-5-8-16(18)11-15/h6-7,9-10,15-16,18,20H,3-5,8,11-12H2,1-2H3/b19-13-/t15-,16-,18+/m1/s1 |
| InChIKey | HTVCQQBVBMJBTE-NXOLRHJFSA-N |
| XLogP | 3.73 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|