C19H13F3N8O7 — CID 98394095
(2E,3S)-2-(methylhydrazinylidene)-3-nitro-3-(7-nitroquinoxalin-2-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 98394095) has the molecular formula C19H13F3N8O7 and a molecular weight of 522.36 g/mol. Its IUPAC name is (2E,3S)-2-(methylhydrazinylidene)-3-nitro-3-(7-nitroquinoxalin-2-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2E,3S)-2-(methylhydrazinylidene)-3-nitro-3-(7-nitroquinoxalin-2-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 98394095 |
| Molecular Formula | C19H13F3N8O7 |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | (2E,3S)-2-(methylhydrazinylidene)-3-nitro-3-(7-nitroquinoxalin-2-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CN/N=C(/C(=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])[C@H](c1cnc2ccc([N+](=O)[O-])cc2n1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H13F3N8O7/c1-23-27-16(18(31)26-12-4-2-9(19(20,21)22)6-15(12)29(34)35)17(30(36)37)14-8-24-11-5-3-10(28(32)33)7-13(11)25-14/h2-8,17,23H,1H3,(H,26,31)/b27-16+/t17-/m0/s1 |
| InChIKey | KKNHFQQLPYQEGG-DCMOEJRUSA-N |
| XLogP | 3.00 |
| TPSA | 208.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|