C14H16N4O2S — CID 98426080
(4aR,5S,7aS)-5-acetyl-3-methylsulfanyl-7-phenyl-2,4a,5,7a-tetrahydro-1H-pyrrolo[3,2-e][1,2,4]triazin-6-one (PubChem CID 98426080) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is (4aR,5S,7aS)-5-acetyl-3-methylsulfanyl-7-phenyl-2,4a,5,7a-tetrahydro-1H-pyrrolo[3,2-e][1,2,4]triazin-6-one.
| Compound Name | (4aR,5S,7aS)-5-acetyl-3-methylsulfanyl-7-phenyl-2,4a,5,7a-tetrahydro-1H-pyrrolo[3,2-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 98426080 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (4aR,5S,7aS)-5-acetyl-3-methylsulfanyl-7-phenyl-2,4a,5,7a-tetrahydro-1H-pyrrolo[3,2-e][1,2,4]triazin-6-one |
| SMILES | CSC1=N[C@@H]2[C@@H](C(C)=O)C(=O)N(c3ccccc3)[C@H]2NN1 |
| InChI | InChI=1S/C14H16N4O2S/c1-8(19)10-11-12(16-17-14(15-11)21-2)18(13(10)20)9-6-4-3-5-7-9/h3-7,10-12,16H,1-2H3,(H,15,17)/t10-,11-,12-/m1/s1 |
| InChIKey | DQZQSFIODUGNKW-IJLUTSLNSA-N |
| XLogP | 0.76 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|