C16H12F2N2O2S — CID 98463823
(2R)-2-cyano-N-(2,4-difluorophenyl)-3-(3-ethylthiophen-2-yl)-3-oxopropanamide (PubChem CID 98463823) has the molecular formula C16H12F2N2O2S and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R)-2-cyano-N-(2,4-difluorophenyl)-3-(3-ethylthiophen-2-yl)-3-oxopropanamide.
| Compound Name | (2R)-2-cyano-N-(2,4-difluorophenyl)-3-(3-ethylthiophen-2-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 98463823 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2R)-2-cyano-N-(2,4-difluorophenyl)-3-(3-ethylthiophen-2-yl)-3-oxopropanamide |
| SMILES | CCc1ccsc1C(=O)[C@@H](C#N)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H12F2N2O2S/c1-2-9-5-6-23-15(9)14(21)11(8-19)16(22)20-13-4-3-10(17)7-12(13)18/h3-7,11H,2H2,1H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | NWLWPMKBUBGHKG-LLVKDONJSA-N |
| XLogP | 3.55 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|