C9H13NO2 — CID 98513300
(1S,3Z,5S)-3-hydroxyimino-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 98513300) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (1S,3Z,5S)-3-hydroxyimino-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (1S,3Z,5S)-3-hydroxyimino-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 98513300 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (1S,3Z,5S)-3-hydroxyimino-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2C/C(=N/O)C(=O)[C@H]1C2 |
| InChI | InChI=1S/C9H13NO2/c1-9(2)5-3-6(9)8(11)7(4-5)10-12/h5-6,12H,3-4H2,1-2H3/b10-7-/t5-,6+/m0/s1 |
| InChIKey | OIKZDVAJIRWRTP-MZWUOHRUSA-N |
| XLogP | 1.45 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|