C23H21O2P — CID 98531958
(1R,2S)-1-benzyl-1-oxo-2,5-diphenyl-2,3-dihydro-1λ5-phosphol-4-ol (PubChem CID 98531958) has the molecular formula C23H21O2P and a molecular weight of 360.39 g/mol. Its IUPAC name is (1R,2S)-1-benzyl-1-oxo-2,5-diphenyl-2,3-dihydro-1λ5-phosphol-4-ol.
| Compound Name | (1R,2S)-1-benzyl-1-oxo-2,5-diphenyl-2,3-dihydro-1λ5-phosphol-4-ol |
|---|---|
| PubChem CID | 98531958 |
| Molecular Formula | C23H21O2P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (1R,2S)-1-benzyl-1-oxo-2,5-diphenyl-2,3-dihydro-1λ5-phosphol-4-ol |
| SMILES | O=[P@@]1(Cc2ccccc2)C(c2ccccc2)=C(O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H21O2P/c24-21-16-22(19-12-6-2-7-13-19)26(25,17-18-10-4-1-5-11-18)23(21)20-14-8-3-9-15-20/h1-15,22,24H,16-17H2/t22-,26+/m0/s1 |
| InChIKey | MJSUUSHGYQJORK-BKMJKUGQSA-N |
| XLogP | 6.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|