C17H22N4O3 — CID 98895093
(3aR,6S,6aR)-N-(furan-2-ylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895093) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3aR,6S,6aR)-N-(furan-2-ylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-N-(furan-2-ylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895093 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3aR,6S,6aR)-N-(furan-2-ylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | Cn1cc(CN2C[C@H](C(=O)NCc3ccco3)[C@H]3OCC[C@H]32)cn1 |
| InChI | InChI=1S/C17H22N4O3/c1-20-9-12(7-19-20)10-21-11-14(16-15(21)4-6-24-16)17(22)18-8-13-3-2-5-23-13/h2-3,5,7,9,14-16H,4,6,8,10-11H2,1H3,(H,18,22)/t14-,15+,16+/m0/s1 |
| InChIKey | XCAZSDOJWKTNRW-ARFHVFGLSA-N |
| XLogP | 0.92 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |