C19H17BrClN3O3 — CID 98913126
(E)-N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 98913126) has the molecular formula C19H17BrClN3O3 and a molecular weight of 450.72 g/mol. Its IUPAC name is (E)-N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98913126 |
| Molecular Formula | C19H17BrClN3O3 |
| Molecular Weight | 450.72 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | (E)-N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cn3cc(Br)ccc3n2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H17BrClN3O3/c1-26-16-8-12(7-15(21)19(16)27-2)3-6-18(25)22-9-14-11-24-10-13(20)4-5-17(24)23-14/h3-8,10-11H,9H2,1-2H3,(H,22,25)/b6-3+ |
| InChIKey | DLHSIOYUAYWTCP-ZZXKWVIFSA-N |
| XLogP | 4.10 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|