C26H26N2O5S — CID 99129523
(1S,6S)-6-[[4-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 99129523) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is (1S,6S)-6-[[4-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[[4-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 99129523 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (1S,6S)-6-[[4-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C[C@@H](Sc3ccc(NC(=O)[C@H]4CC=CC[C@@H]4C(=O)O)cc3)C2=O)cc1C |
| InChI | InChI=1S/C26H26N2O5S/c1-15-7-10-18(13-16(15)2)28-23(29)14-22(25(28)31)34-19-11-8-17(9-12-19)27-24(30)20-5-3-4-6-21(20)26(32)33/h3-4,7-13,20-22H,5-6,14H2,1-2H3,(H,27,30)(H,32,33)/t20-,21-,22+/m0/s1 |
| InChIKey | UHXGWGDLZPTNPY-FDFHNCONSA-N |
| XLogP | 4.33 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|