C8H14O5 — CID 99373377
methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate (PubChem CID 99373377) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate.
| Compound Name | methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate |
|---|---|
| PubChem CID | 99373377 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](OC)O[C@@H]1OC |
| InChI | InChI=1S/C8H14O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h5-6,8H,4H2,1-3H3/t5-,6+,8+/m1/s1 |
| InChIKey | KOTZIJSZRBWTCM-CHKWXVPMSA-N |
| XLogP | 0.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |