methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate

C8H14O5 — CID 99373377

IUPACmethyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate
SMILESCOC(=O)[C@H]1C[C@@H](OC)O[C@@H]1OC
InChIInChI=1S/C8H14O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h5-6,8H,4H2,1-3H3/t5-,6+,8+/m1/s1
InChIKeyKOTZIJSZRBWTCM-CHKWXVPMSA-N
MW190.19 g/mol
LogP0.14
Rot. Bonds3

About methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate

methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate (PubChem CID 99373377) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate
PubChem CID99373377
Molecular FormulaC8H14O5
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Namemethyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate
SMILESCOC(=O)[C@H]1C[C@@H](OC)O[C@@H]1OC
InChIInChI=1S/C8H14O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h5-6,8H,4H2,1-3H3/t5-,6+,8+/m1/s1
InChIKeyKOTZIJSZRBWTCM-CHKWXVPMSA-N
XLogP0.14
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 50.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate?
The IUPAC name of methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate (CID 99373377) is methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate.
What is the SMILES notation for methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate?
The canonical SMILES for methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate is COC(=O)[C@H]1C[C@@H](OC)O[C@@H]1OC.
What is the InChIKey of methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate?
The InChIKey is KOTZIJSZRBWTCM-CHKWXVPMSA-N. The full InChI is InChI=1S/C8H14O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h5-6,8H,4H2,1-3H3/t5-,6+,8+/m1/s1.
What are the key properties of methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate?
methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate has a molecular weight of 190.19 g/mol, XLogP of 0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S,5S)-2,5-dimethoxyoxolane-3-carboxylate is sourced from PubChem (CID 99373377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).