C11H9F2N3O2S — CID 99619672
N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide (PubChem CID 99619672) has the molecular formula C11H9F2N3O2S and a molecular weight of 285.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99619672 |
| Molecular Formula | C11H9F2N3O2S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
| SMILES | O=C(NCC(F)F)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C11H9F2N3O2S/c12-8(13)5-14-9(17)6-1-3-7(4-2-6)10-15-16-11(19)18-10/h1-4,8H,5H2,(H,14,17)(H,16,19) |
| InChIKey | OXMFHYHSEASJQH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|