C34H46O10S2 — CID 99670624
CID 99670624 (PubChem CID 99670624) has the molecular formula C34H46O10S2 and a molecular weight of 678.87 g/mol.
| Compound Name | CID 99670624 |
|---|---|
| PubChem CID | 99670624 |
| Molecular Formula | C34H46O10S2 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | — |
| SMILES | COc1ccc(S(=O)(=O)OC[C@]2(C)[C@@H](OS(=O)(=O)c3ccc(OC)cc3)CC[C@@]3(C)[C@H]2CC[C@@H](C)[C@@]32CC[C@]3(CCOC3)O2)cc1 |
| InChI | InChI=1S/C34H46O10S2/c1-24-6-15-29-31(2,22-42-45(35,36)27-11-7-25(39-4)8-12-27)30(43-46(37,38)28-13-9-26(40-5)10-14-28)16-17-32(29,3)34(24)19-18-33(44-34)20-21-41-23-33/h7-14,24,29-30H,6,15-23H2,1-5H3/t24-,29+,30+,31+,32+,33-,34+/m1/s1 |
| InChIKey | KLLASXMLVKAYIW-IGTSMTJHSA-N |
| XLogP | 5.74 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|