About CID 99670624
CID 99670624 (PubChem CID 99670624) has the molecular formula C34H46O10S2
and a molecular weight of 678.87 g/mol.
Molecular Properties
| Compound Name | CID 99670624 |
| PubChem CID | 99670624 |
| Molecular Formula | C34H46O10S2 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | — |
| SMILES | COc1ccc(S(=O)(=O)OC[C@]2(C)[C@@H](OS(=O)(=O)c3ccc(OC)cc3)CC[C@@]3(C)[C@H]2CC[C@@H](C)[C@@]32CC[C@]3(CCOC3)O2)cc1 |
| InChI | InChI=1S/C34H46O10S2/c1-24-6-15-29-31(2,22-42-45(35,36)27-11-7-25(39-4)8-12-27)30(43-46(37,38)28-13-9-26(40-5)10-14-28)16-17-32(29,3)34(24)19-18-33(44-34)20-21-41-23-33/h7-14,24,29-30H,6,15-23H2,1-5H3/t24-,29+,30+,31+,32+,33-,34+/m1/s1 |
| InChIKey | KLLASXMLVKAYIW-IGTSMTJHSA-N |
| XLogP | 5.74 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze CID 99670624 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 99670624?
The IUPAC name of CID 99670624 (CID 99670624) is not available.
What is the SMILES notation for CID 99670624?
The canonical SMILES for CID 99670624 is COc1ccc(S(=O)(=O)OC[C@]2(C)[C@@H](OS(=O)(=O)c3ccc(OC)cc3)CC[C@@]3(C)[C@H]2CC[C@@H](C)[C@@]32CC[C@]3(CCOC3)O2)cc1.
What is the InChIKey of CID 99670624?
The InChIKey is KLLASXMLVKAYIW-IGTSMTJHSA-N. The full InChI is InChI=1S/C34H46O10S2/c1-24-6-15-29-31(2,22-42-45(35,36)27-11-7-25(39-4)8-12-27)30(43-46(37,38)28-13-9-26(40-5)10-14-28)16-17-32(29,3)34(24)19-18-33(44-34)20-21-41-23-33/h7-14,24,29-30H,6,15-23H2,1-5H3/t24-,29+,30+,31+,32+,33-,34+/m1/s1.
What are the key properties of CID 99670624?
CID 99670624 has a molecular weight of 678.87 g/mol, XLogP of 5.74, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 99670624 is sourced from PubChem (CID 99670624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).