C24H29NO4S3 — CID 997413
ethyl (2Z)-2-[6-ethoxy-2,2-dimethyl-1-(3-methylbutanoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate (PubChem CID 997413) has the molecular formula C24H29NO4S3 and a molecular weight of 491.70 g/mol. Its IUPAC name is ethyl (2Z)-2-[6-ethoxy-2,2-dimethyl-1-(3-methylbutanoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl (2Z)-2-[6-ethoxy-2,2-dimethyl-1-(3-methylbutanoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 997413 |
| Molecular Formula | C24H29NO4S3 |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | ethyl (2Z)-2-[6-ethoxy-2,2-dimethyl-1-(3-methylbutanoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=CS/C(=C2/C(=S)C(C)(C)N(C(=O)CC(C)C)c3ccc(OCC)cc32)S1 |
| InChI | InChI=1S/C24H29NO4S3/c1-7-28-15-9-10-17-16(12-15)20(23-31-13-18(32-23)22(27)29-8-2)21(30)24(5,6)25(17)19(26)11-14(3)4/h9-10,12-14H,7-8,11H2,1-6H3/b23-20- |
| InChIKey | SETJZVGYOVVJDH-ATJXCDBQSA-N |
| XLogP | 6.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|