C16H14N4O3 — CID 99793891
2-benzamidoethyl pyrazolo[1,5-a]pyrazine-3-carboxylate (PubChem CID 99793891) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-benzamidoethyl pyrazolo[1,5-a]pyrazine-3-carboxylate.
| Compound Name | 2-benzamidoethyl pyrazolo[1,5-a]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 99793891 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-benzamidoethyl pyrazolo[1,5-a]pyrazine-3-carboxylate |
| SMILES | O=C(NCCOC(=O)c1cnn2ccncc12)c1ccccc1 |
| InChI | InChI=1S/C16H14N4O3/c21-15(12-4-2-1-3-5-12)18-7-9-23-16(22)13-10-19-20-8-6-17-11-14(13)20/h1-6,8,10-11H,7,9H2,(H,18,21) |
| InChIKey | JRSYGXVDBNKTDU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|