C16H22N2O3S — CID 99857059
(5R)-6,6,8,8-tetramethyl-3-(2-thiophen-2-ylethyl)-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 99857059) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (5R)-6,6,8,8-tetramethyl-3-(2-thiophen-2-ylethyl)-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R)-6,6,8,8-tetramethyl-3-(2-thiophen-2-ylethyl)-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 99857059 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (5R)-6,6,8,8-tetramethyl-3-(2-thiophen-2-ylethyl)-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC1(C)C[C@@]2(NC(=O)N(CCc3cccs3)C2=O)C(C)(C)O1 |
| InChI | InChI=1S/C16H22N2O3S/c1-14(2)10-16(15(3,4)21-14)12(19)18(13(20)17-16)8-7-11-6-5-9-22-11/h5-6,9H,7-8,10H2,1-4H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | RWCPEPNFZBERIL-INIZCTEOSA-N |
| XLogP | 2.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|