C12H11Cl2N3O — CID 99901962
(4E)-3-(2,4-dichlorophenyl)-4-(dimethylaminomethylidene)-1H-pyrazol-5-one (PubChem CID 99901962) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is (4E)-3-(2,4-dichlorophenyl)-4-(dimethylaminomethylidene)-1H-pyrazol-5-one.
| Compound Name | (4E)-3-(2,4-dichlorophenyl)-4-(dimethylaminomethylidene)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 99901962 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (4E)-3-(2,4-dichlorophenyl)-4-(dimethylaminomethylidene)-1H-pyrazol-5-one |
| SMILES | CN(C)/C=C1/C(=O)NN=C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O/c1-17(2)6-9-11(15-16-12(9)18)8-4-3-7(13)5-10(8)14/h3-6H,1-2H3,(H,16,18)/b9-6+ |
| InChIKey | HLKARYACIUIZDW-RMKNXTFCSA-N |
| XLogP | 2.27 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|