C17H28O7 — CID 99927051
(3S,4R)-3-hydroxytetradec-13-ene-1,3,4-tricarboxylic acid (PubChem CID 99927051) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (3S,4R)-3-hydroxytetradec-13-ene-1,3,4-tricarboxylic acid.
| Compound Name | (3S,4R)-3-hydroxytetradec-13-ene-1,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 99927051 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3S,4R)-3-hydroxytetradec-13-ene-1,3,4-tricarboxylic acid |
| SMILES | C=CCCCCCCCC[C@@H](C(=O)O)[C@@](O)(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H28O7/c1-2-3-4-5-6-7-8-9-10-13(15(20)21)17(24,16(22)23)12-11-14(18)19/h2,13,24H,1,3-12H2,(H,18,19)(H,20,21)(H,22,23)/t13-,17-/m0/s1 |
| InChIKey | KAEUHBWCUQSEQR-GUYCJALGSA-N |
| XLogP | 2.67 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|