C15H17ClN2O — CID 99936059
1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-chlorophenyl)-1-methylurea (PubChem CID 99936059) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-chlorophenyl)-1-methylurea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-chlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 99936059 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(4-chlorophenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(Cl)cc1)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H17ClN2O/c1-18(14-9-10-2-3-11(14)8-10)15(19)17-13-6-4-12(16)5-7-13/h2-7,10-11,14H,8-9H2,1H3,(H,17,19)/t10-,11+,14-/m0/s1 |
| InChIKey | VBPUHQSYDZQJKL-WDMOLILDSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|