C6H2F4O2S — CID 99939044
2,3,4-trifluorobenzenesulfonyl fluoride (PubChem CID 99939044) has the molecular formula C6H2F4O2S and a molecular weight of 214.14 g/mol. Its IUPAC name is 2,3,4-trifluorobenzenesulfonyl fluoride.
| Compound Name | 2,3,4-trifluorobenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 99939044 |
| Molecular Formula | C6H2F4O2S |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 2,3,4-trifluorobenzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C6H2F4O2S/c7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-2H |
| InChIKey | QSTVOESYDQCSJJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|