About fluoranthene
fluoranthene (PubChem CID 9154) has the molecular formula C16H10
and a molecular weight of 202.26 g/mol. Its IUPAC name is fluoranthene.
Molecular Properties
| Compound Name | fluoranthene |
| PubChem CID | 9154 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | fluoranthene |
| SMILES | c1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H |
| InChIKey | GVEPBJHOBDJJJI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoranthene?
The IUPAC name of fluoranthene (CID 9154) is fluoranthene.
What is the SMILES notation for fluoranthene?
The canonical SMILES for fluoranthene is c1ccc2c(c1)-c1cccc3cccc-2c13.
What is the InChIKey of fluoranthene?
The InChIKey is GVEPBJHOBDJJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H.
What are the key properties of fluoranthene?
fluoranthene has a molecular weight of 202.26 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoranthene is sourced from PubChem (CID 9154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).