About acridin-9-amine
acridin-9-amine (PubChem CID 7019) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is acridin-9-amine.
Molecular Properties
| Compound Name | acridin-9-amine |
| PubChem CID | 7019 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | acridin-9-amine |
| SMILES | Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15) |
| InChIKey | XJGFWWJLMVZSIG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridin-9-amine?
The IUPAC name of acridin-9-amine (CID 7019) is acridin-9-amine.
What is the SMILES notation for acridin-9-amine?
The canonical SMILES for acridin-9-amine is Nc1c2ccccc2nc2ccccc12.
What is the InChIKey of acridin-9-amine?
The InChIKey is XJGFWWJLMVZSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15).
What are the key properties of acridin-9-amine?
acridin-9-amine has a molecular weight of 194.24 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridin-9-amine is sourced from PubChem (CID 7019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).