C12H6Cl4O2S — CID 2406
View drug profile → bithionol2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfanylphenol (PubChem CID 2406) has the molecular formula C12H6Cl4O2S and a molecular weight of 356.06 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfanylphenol.
| Compound Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfanylphenol |
|---|---|
| PubChem CID | 2406 |
| Molecular Formula | C12H6Cl4O2S |
| Molecular Weight | 356.06 g/mol |
| Exact Mass | 353.88 |
| IUPAC Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfanylphenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |