About phenylsulfanylurea
phenylsulfanylurea (PubChem CID 22219022) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is phenylsulfanylurea.
Molecular Properties
| Compound Name | phenylsulfanylurea |
| PubChem CID | 22219022 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | phenylsulfanylurea |
| SMILES | NC(=O)NSc1ccccc1 |
| InChI | InChI=1S/C7H8N2OS/c8-7(10)9-11-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | IGXIQOFPTUWHFL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenylsulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylurea?
The IUPAC name of phenylsulfanylurea (CID 22219022) is phenylsulfanylurea.
What is the SMILES notation for phenylsulfanylurea?
The canonical SMILES for phenylsulfanylurea is NC(=O)NSc1ccccc1.
What is the InChIKey of phenylsulfanylurea?
The InChIKey is IGXIQOFPTUWHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c8-7(10)9-11-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10).
What are the key properties of phenylsulfanylurea?
phenylsulfanylurea has a molecular weight of 168.22 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylurea is sourced from PubChem (CID 22219022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).