C6H6O3 — CID 359
View drug profile → phloroglucinolbenzene-1,3,5-triol (PubChem CID 359) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is benzene-1,3,5-triol.
| Compound Name | benzene-1,3,5-triol |
|---|---|
| PubChem CID | 359 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | benzene-1,3,5-triol |
| SMILES | Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
| InChIKey | QCDYQQDYXPDABM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |