C11H13NO3 — CID 6260
View drug profile → thurfyl nicotinateoxolan-2-ylmethyl pyridine-3-carboxylate (PubChem CID 6260) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is oxolan-2-ylmethyl pyridine-3-carboxylate.
| Compound Name | oxolan-2-ylmethyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6260 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | oxolan-2-ylmethyl pyridine-3-carboxylate |
| SMILES | O=C(OCC1CCCO1)c1cccnc1 |
| InChI | InChI=1S/C11H13NO3/c13-11(9-3-1-5-12-7-9)15-8-10-4-2-6-14-10/h1,3,5,7,10H,2,4,6,8H2 |
| InChIKey | RQAITHJHUFFEIV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |