C22H22Cl2N4O4 — CID 10050705
N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-methoxyethoxy)-5,10-dihydropyrimido[4,5-b]quinolin-4-amine (PubChem CID 10050705) has the molecular formula C22H22Cl2N4O4 and a molecular weight of 477.35 g/mol. Its IUPAC name is N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-methoxyethoxy)-5,10-dihydropyrimido[4,5-b]quinolin-4-amine.
| Compound Name | N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-methoxyethoxy)-5,10-dihydropyrimido[4,5-b]quinolin-4-amine |
|---|---|
| PubChem CID | 10050705 |
| Molecular Formula | C22H22Cl2N4O4 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-methoxyethoxy)-5,10-dihydropyrimido[4,5-b]quinolin-4-amine |
| SMILES | COCCOc1cc2c(cc1OC)Cc1c(Nc3cc(OC)c(Cl)cc3Cl)ncnc1N2 |
| InChI | InChI=1S/C22H22Cl2N4O4/c1-29-4-5-32-20-9-16-12(7-19(20)31-3)6-13-21(27-16)25-11-26-22(13)28-17-10-18(30-2)15(24)8-14(17)23/h7-11H,4-6H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | XMAKXDZNYHCNHY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|