C26H26Cl2N4O4 — CID 91020683
N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-morpholin-2-ylethoxy)benzo[g]quinazolin-4-amine (PubChem CID 91020683) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-morpholin-2-ylethoxy)benzo[g]quinazolin-4-amine.
| Compound Name | N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-morpholin-2-ylethoxy)benzo[g]quinazolin-4-amine |
|---|---|
| PubChem CID | 91020683 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-(2,4-dichloro-5-methoxyphenyl)-7-methoxy-8-(2-morpholin-2-ylethoxy)benzo[g]quinazolin-4-amine |
| SMILES | COc1cc(Nc2ncnc3cc4cc(OCCC5CNCCO5)c(OC)cc4cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl2N4O4/c1-33-23-12-22(19(27)11-20(23)28)32-26-18-7-15-9-24(34-2)25(10-16(15)8-21(18)30-14-31-26)36-5-3-17-13-29-4-6-35-17/h7-12,14,17,29H,3-6,13H2,1-2H3,(H,30,31,32) |
| InChIKey | GUDINVFNBWYAKL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|