C23H28N4O3 — CID 142675011
7-methoxy-6-(morpholin-2-ylmethoxy)-N-(4-propylphenyl)quinazolin-4-amine (PubChem CID 142675011) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 7-methoxy-6-(morpholin-2-ylmethoxy)-N-(4-propylphenyl)quinazolin-4-amine.
| Compound Name | 7-methoxy-6-(morpholin-2-ylmethoxy)-N-(4-propylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 142675011 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 7-methoxy-6-(morpholin-2-ylmethoxy)-N-(4-propylphenyl)quinazolin-4-amine |
| SMILES | CCCc1ccc(Nc2ncnc3cc(OC)c(OCC4CNCCO4)cc23)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-3-4-16-5-7-17(8-6-16)27-23-19-11-22(30-14-18-13-24-9-10-29-18)21(28-2)12-20(19)25-15-26-23/h5-8,11-12,15,18,24H,3-4,9-10,13-14H2,1-2H3,(H,25,26,27) |
| InChIKey | ZEFNDTSHDXECBT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |