About (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide
(3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide (PubChem CID 100636603) has the molecular formula C18H27NO5
and a molecular weight of 337.42 g/mol. Its IUPAC name is (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide.
Molecular Properties
| Compound Name | (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide |
| PubChem CID | 100636603 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide |
| SMILES | CC(C)(O)C[C@H](CO)NC(=O)C[C@H](O)CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H27NO5/c1-18(2,24)11-14(12-20)19-17(23)10-16(22)9-15(21)8-13-6-4-3-5-7-13/h3-7,14,16,20,22,24H,8-12H2,1-2H3,(H,19,23)/t14-,16-/m1/s1 |
| InChIKey | ZCEYUYRVYFKPRM-GDBMZVCRSA-N |
| XLogP | 0.58 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide?
The IUPAC name of (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide (CID 100636603) is (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide.
What is the SMILES notation for (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide?
The canonical SMILES for (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide is CC(C)(O)C[C@H](CO)NC(=O)C[C@H](O)CC(=O)Cc1ccccc1.
What is the InChIKey of (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide?
The InChIKey is ZCEYUYRVYFKPRM-GDBMZVCRSA-N. The full InChI is InChI=1S/C18H27NO5/c1-18(2,24)11-14(12-20)19-17(23)10-16(22)9-15(21)8-13-6-4-3-5-7-13/h3-7,14,16,20,22,24H,8-12H2,1-2H3,(H,19,23)/t14-,16-/m1/s1.
What are the key properties of (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide?
(3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide has a molecular weight of 337.42 g/mol, XLogP of 0.58, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[(2R)-1,4-dihydroxy-4-methylpentan-2-yl]-3-hydroxy-5-oxo-6-phenylhexanamide is sourced from PubChem (CID 100636603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).