C17H19ClN4O5 — CID 10069237
(2,5-dioxopyrrolidin-1-yl) 4-[benzyl-(2-chloroethyldiazenyl)amino]-4-oxobutanoate (PubChem CID 10069237) has the molecular formula C17H19ClN4O5 and a molecular weight of 394.82 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[benzyl-(2-chloroethyldiazenyl)amino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[benzyl-(2-chloroethyldiazenyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 10069237 |
| Molecular Formula | C17H19ClN4O5 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[benzyl-(2-chloroethyldiazenyl)amino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)N(Cc1ccccc1)/N=N/CCCl)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H19ClN4O5/c18-10-11-19-20-21(12-13-4-2-1-3-5-13)14(23)8-9-17(26)27-22-15(24)6-7-16(22)25/h1-5H,6-12H2/b20-19+ |
| InChIKey | MENKWACITFDZQK-FMQUCBEESA-N |
| XLogP | 2.01 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|