C19H27N2O4+ — CID 100798704
(2R)-1-(2-methylbut-3-yn-2-yloxy)-3-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]propan-2-ol (PubChem CID 100798704) has the molecular formula C19H27N2O4+ and a molecular weight of 347.44 g/mol. Its IUPAC name is (2R)-1-(2-methylbut-3-yn-2-yloxy)-3-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(2-methylbut-3-yn-2-yloxy)-3-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100798704 |
| Molecular Formula | C19H27N2O4+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2R)-1-(2-methylbut-3-yn-2-yloxy)-3-[1-[(4-nitrophenyl)methyl]pyrrolidin-1-ium-1-yl]propan-2-ol |
| SMILES | C#CC(C)(C)OC[C@H](O)C[N+]1(Cc2ccc([N+](=O)[O-])cc2)CCCC1 |
| InChI | InChI=1S/C19H27N2O4/c1-4-19(2,3)25-15-18(22)14-21(11-5-6-12-21)13-16-7-9-17(10-8-16)20(23)24/h1,7-10,18,22H,5-6,11-15H2,2-3H3/q+1/t18-/m1/s1 |
| InChIKey | NNDZOKDWEVFNAL-GOSISDBHSA-N |
| XLogP | 2.49 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|