C17H19NO — CID 10083619
(4R,6S)-4-methyl-3,6-diphenyl-1,3-oxazinane (PubChem CID 10083619) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (4R,6S)-4-methyl-3,6-diphenyl-1,3-oxazinane.
| Compound Name | (4R,6S)-4-methyl-3,6-diphenyl-1,3-oxazinane |
|---|---|
| PubChem CID | 10083619 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4R,6S)-4-methyl-3,6-diphenyl-1,3-oxazinane |
| SMILES | C[C@@H]1C[C@@H](c2ccccc2)OCN1c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-14-12-17(15-8-4-2-5-9-15)19-13-18(14)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | JYXOGFINRFKIKN-PBHICJAKSA-N |
| XLogP | 4.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |