About [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium
[(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium (PubChem CID 100919752) has the molecular formula C17H28NO+
and a molecular weight of 262.42 g/mol. Its IUPAC name is [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium.
Molecular Properties
| Compound Name | [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium |
| PubChem CID | 100919752 |
| Molecular Formula | C17H28NO+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium |
| SMILES | C[C@@]1(O)CCCC[C@@H]1[C@@H](c1ccccc1)[N+](C)(C)C |
| InChI | InChI=1S/C17H28NO/c1-17(19)13-9-8-12-15(17)16(18(2,3)4)14-10-6-5-7-11-14/h5-7,10-11,15-16,19H,8-9,12-13H2,1-4H3/q+1/t15-,16-,17-/m1/s1 |
| InChIKey | USILAIKLLAHUMC-BRWVUGGUSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium?
The IUPAC name of [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium (CID 100919752) is [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium.
What is the SMILES notation for [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium?
The canonical SMILES for [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium is C[C@@]1(O)CCCC[C@@H]1[C@@H](c1ccccc1)[N+](C)(C)C.
What is the InChIKey of [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium?
The InChIKey is USILAIKLLAHUMC-BRWVUGGUSA-N. The full InChI is InChI=1S/C17H28NO/c1-17(19)13-9-8-12-15(17)16(18(2,3)4)14-10-6-5-7-11-14/h5-7,10-11,15-16,19H,8-9,12-13H2,1-4H3/q+1/t15-,16-,17-/m1/s1.
What are the key properties of [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium?
[(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium has a molecular weight of 262.42 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-[(1R,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]-trimethylazanium is sourced from PubChem (CID 100919752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).