C12H22N2O4-2 — CID 100940551
(2S)-2-[2-[[(1S)-1-carboxylato-2-methylpropyl]amino]ethylamino]-3-methylbutanoate (PubChem CID 100940551) has the molecular formula C12H22N2O4-2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-2-[2-[[(1S)-1-carboxylato-2-methylpropyl]amino]ethylamino]-3-methylbutanoate.
| Compound Name | (2S)-2-[2-[[(1S)-1-carboxylato-2-methylpropyl]amino]ethylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 100940551 |
| Molecular Formula | C12H22N2O4-2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (2S)-2-[2-[[(1S)-1-carboxylato-2-methylpropyl]amino]ethylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NCCN[C@H](C(=O)[O-])C(C)C)C(=O)[O-] |
| InChI | InChI=1S/C12H24N2O4/c1-7(2)9(11(15)16)13-5-6-14-10(8(3)4)12(17)18/h7-10,13-14H,5-6H2,1-4H3,(H,15,16)(H,17,18)/p-2/t9-,10-/m0/s1 |
| InChIKey | HSLGZAHUVCIVIP-UWVGGRQHSA-L |
| XLogP | -2.29 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|