C5H11N2NaO4S — CID 176515650
sodium (2S)-3-methyl-2-(sulfamoylamino)butanoate (PubChem CID 176515650) has the molecular formula C5H11N2NaO4S and a molecular weight of 218.21 g/mol. Its IUPAC name is sodium (2S)-3-methyl-2-(sulfamoylamino)butanoate.
| Compound Name | sodium (2S)-3-methyl-2-(sulfamoylamino)butanoate |
|---|---|
| PubChem CID | 176515650 |
| Molecular Formula | C5H11N2NaO4S |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | sodium (2S)-3-methyl-2-(sulfamoylamino)butanoate |
| SMILES | CC(C)[C@H](NS(N)(=O)=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H12N2O4S.Na/c1-3(2)4(5(8)9)7-12(6,10)11;/h3-4,7H,1-2H3,(H,8,9)(H2,6,10,11);/q;+1/p-1/t4-;/m0./s1 |
| InChIKey | ZSHVSCCSLSCIGX-WCCKRBBISA-M |
| XLogP | -5.44 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |