C12H20CuN2O8 — CID 88693916
copper bis((2S,3R)-3-hydroxy-2-(2-oxoethylamino)butanoate) (PubChem CID 88693916) has the molecular formula C12H20CuN2O8 and a molecular weight of 383.84 g/mol. Its IUPAC name is copper bis((2S,3R)-3-hydroxy-2-(2-oxoethylamino)butanoate).
| Compound Name | copper bis((2S,3R)-3-hydroxy-2-(2-oxoethylamino)butanoate) |
|---|---|
| PubChem CID | 88693916 |
| Molecular Formula | C12H20CuN2O8 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | copper bis((2S,3R)-3-hydroxy-2-(2-oxoethylamino)butanoate) |
| SMILES | C[C@@H](O)[C@H](NCC=O)C(=O)[O-].C[C@@H](O)[C@H](NCC=O)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C6H11NO4.Cu/c2*1-4(9)5(6(10)11)7-2-3-8;/h2*3-5,7,9H,2H2,1H3,(H,10,11);/q;;+2/p-2/t2*4-,5+;/m11./s1 |
| InChIKey | GYODBADJKNTCNL-ASZNEFJQSA-L |
| XLogP | -5.45 |
| TPSA | 178.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|