C17H24O6 — CID 100946158
(1S,2S,6S,7R)-10-acetyl-4,9,9-trimethoxy-2,4-dimethyl-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one (PubChem CID 100946158) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (1S,2S,6S,7R)-10-acetyl-4,9,9-trimethoxy-2,4-dimethyl-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one.
| Compound Name | (1S,2S,6S,7R)-10-acetyl-4,9,9-trimethoxy-2,4-dimethyl-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one |
|---|---|
| PubChem CID | 100946158 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1S,2S,6S,7R)-10-acetyl-4,9,9-trimethoxy-2,4-dimethyl-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one |
| SMILES | COC1(C)C[C@H]2[C@H]3C=C(C(C)=O)[C@H](C(OC)(OC)C3=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C17H24O6/c1-9(18)10-7-11-12-8-15(2,20-4)23-16(12,3)13(10)17(21-5,22-6)14(11)19/h7,11-13H,8H2,1-6H3/t11-,12+,13+,15?,16+/m1/s1 |
| InChIKey | GAIPAYKVZQEBSD-XQZHBGCKSA-N |
| XLogP | 1.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|