C17H28O4Si — CID 11336304
(1R,4R,7R)-3,3-dimethoxy-5-methyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one (PubChem CID 11336304) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (1R,4R,7R)-3,3-dimethoxy-5-methyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4R,7R)-3,3-dimethoxy-5-methyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 11336304 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1R,4R,7R)-3,3-dimethoxy-5-methyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C/C=C(/O[Si](C)(C)C)[C@@H]1C[C@@H]2C(C)=C[C@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C17H28O4Si/c1-8-15(21-22(5,6)7)12-10-14-11(2)9-13(12)16(18)17(14,19-3)20-4/h8-9,12-14H,10H2,1-7H3/b15-8+/t12-,13-,14-/m1/s1 |
| InChIKey | APYYWGZRYZIKKG-LOFFPDMDSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|