C19H19NO6 — CID 132567804
methyl (1S,2S,4S)-5-(1,3-benzoxazol-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 132567804) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl (1S,2S,4S)-5-(1,3-benzoxazol-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,4S)-5-(1,3-benzoxazol-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 132567804 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl (1S,2S,4S)-5-(1,3-benzoxazol-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C(c3nc4ccccc4o3)=C[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C19H19NO6/c1-23-18(22)11-9-13-12(8-10(11)16(21)19(13,24-2)25-3)17-20-14-6-4-5-7-15(14)26-17/h4-8,10-11,13H,9H2,1-3H3/t10-,11-,13-/m0/s1 |
| InChIKey | DABBBFIEGOWZSF-GVXVVHGQSA-N |
| XLogP | 2.21 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|