C23H21NO4 — CID 132567809
(1R,4R,7R)-5-(1,3-benzoxazol-2-yl)-3,3-dimethoxy-7-phenylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 132567809) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (1R,4R,7R)-5-(1,3-benzoxazol-2-yl)-3,3-dimethoxy-7-phenylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4R,7R)-5-(1,3-benzoxazol-2-yl)-3,3-dimethoxy-7-phenylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 132567809 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (1R,4R,7R)-5-(1,3-benzoxazol-2-yl)-3,3-dimethoxy-7-phenylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(c3nc4ccccc4o3)[C@H]1C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H21NO4/c1-26-23(27-2)18-13-15(14-8-4-3-5-9-14)16(21(23)25)12-17(18)22-24-19-10-6-7-11-20(19)28-22/h3-12,15-16,18H,13H2,1-2H3/t15-,16+,18+/m0/s1 |
| InChIKey | CUYXUTVYCQTQFA-LZLYRXPVSA-N |
| XLogP | 4.20 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|