C20H42O3Si2 — CID 100947825
tert-butyl-[(3E,5Z)-5-(diethoxymethyl)-6-trimethylsilylhexa-3,5-dienoxy]-dimethylsilane (PubChem CID 100947825) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is tert-butyl-[(3E,5Z)-5-(diethoxymethyl)-6-trimethylsilylhexa-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5Z)-5-(diethoxymethyl)-6-trimethylsilylhexa-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100947825 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | tert-butyl-[(3E,5Z)-5-(diethoxymethyl)-6-trimethylsilylhexa-3,5-dienoxy]-dimethylsilane |
| SMILES | CCOC(OCC)C(=C\[Si](C)(C)C)/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O3Si2/c1-11-21-19(22-12-2)18(17-24(6,7)8)15-13-14-16-23-25(9,10)20(3,4)5/h13,15,17,19H,11-12,14,16H2,1-10H3/b15-13+,18-17- |
| InChIKey | QRYGMGKKSQEWFG-CELSGOLJSA-N |
| XLogP | 6.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|