C12H12O5 — CID 100965739
(2S)-2-(2,4-dimethoxyphenoxy)-2H-furan-5-one (PubChem CID 100965739) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethoxyphenoxy)-2H-furan-5-one.
| Compound Name | (2S)-2-(2,4-dimethoxyphenoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 100965739 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (2S)-2-(2,4-dimethoxyphenoxy)-2H-furan-5-one |
| SMILES | COc1ccc(O[C@@H]2C=CC(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C12H12O5/c1-14-8-3-4-9(10(7-8)15-2)16-12-6-5-11(13)17-12/h3-7,12H,1-2H3/t12-/m0/s1 |
| InChIKey | RDMUDPIJUYWIQB-LBPRGKRZSA-N |
| XLogP | 1.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |