C12H15NO — CID 100979156
(5Z)-3,6-dimethyl-2,4-dihydro-1,3-benzoxazocine (PubChem CID 100979156) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (5Z)-3,6-dimethyl-2,4-dihydro-1,3-benzoxazocine.
| Compound Name | (5Z)-3,6-dimethyl-2,4-dihydro-1,3-benzoxazocine |
|---|---|
| PubChem CID | 100979156 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (5Z)-3,6-dimethyl-2,4-dihydro-1,3-benzoxazocine |
| SMILES | C/C1=C/CN(C)COc2ccccc21 |
| InChI | InChI=1S/C12H15NO/c1-10-7-8-13(2)9-14-12-6-4-3-5-11(10)12/h3-7H,8-9H2,1-2H3/b10-7- |
| InChIKey | NQVKXNMLJFSVGX-YFHOEESVSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |