C31H52NO11P — CID 100980534
(1R,15S,16R,21R,23S)-8-(5-diethoxyphosphorylpentyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 100980534) has the molecular formula C31H52NO11P and a molecular weight of 645.73 g/mol. Its IUPAC name is (1R,15S,16R,21R,23S)-8-(5-diethoxyphosphorylpentyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,21R,23S)-8-(5-diethoxyphosphorylpentyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 100980534 |
| Molecular Formula | C31H52NO11P |
| Molecular Weight | 645.73 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | (1R,15S,16R,21R,23S)-8-(5-diethoxyphosphorylpentyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | CCOP(=O)(CCCCCN1CCOCCO[C@@H]2[C@@H](OCCOCC1)[C@@H](OC)O[C@@H]1COC(c3ccccc3)O[C@@H]21)OCC |
| InChI | InChI=1S/C31H52NO11P/c1-4-40-44(33,41-5-2)23-11-7-10-14-32-15-17-35-19-21-37-28-27-26(24-39-30(43-27)25-12-8-6-9-13-25)42-31(34-3)29(28)38-22-20-36-18-16-32/h6,8-9,12-13,26-31H,4-5,7,10-11,14-24H2,1-3H3/t26-,27-,28+,29-,30?,31+/m1/s1 |
| InChIKey | ITLHKBVUEQRBFX-HMQNZOLESA-N |
| XLogP | 4.03 |
| TPSA | 112.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|