C38H50NO9P — CID 11239419
(1R,15S,16R,18R,21R,23S)-8-(4-diphenylphosphorylbutyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 11239419) has the molecular formula C38H50NO9P and a molecular weight of 695.79 g/mol. Its IUPAC name is (1R,15S,16R,18R,21R,23S)-8-(4-diphenylphosphorylbutyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,18R,21R,23S)-8-(4-diphenylphosphorylbutyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 11239419 |
| Molecular Formula | C38H50NO9P |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | (1R,15S,16R,18R,21R,23S)-8-(4-diphenylphosphorylbutyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2OCCOCCN(CCCCP(=O)(c3ccccc3)c3ccccc3)CCOCCO[C@@H]12 |
| InChI | InChI=1S/C38H50NO9P/c1-41-38-36-35(34-33(47-38)29-46-37(48-34)30-13-5-2-6-14-30)44-26-24-42-22-20-39(21-23-43-25-27-45-36)19-11-12-28-49(40,31-15-7-3-8-16-31)32-17-9-4-10-18-32/h2-10,13-18,33-38H,11-12,19-29H2,1H3/t33-,34-,35+,36-,37-,38+/m1/s1 |
| InChIKey | OSDBLGYDFFOOAW-BWMPUPLRSA-N |
| XLogP | 4.39 |
| TPSA | 94.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|