C28H46NO11P — CID 100980531
(1R,15S,16R,21R,23S)-8-(2-diethoxyphosphorylethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 100980531) has the molecular formula C28H46NO11P and a molecular weight of 603.65 g/mol. Its IUPAC name is (1R,15S,16R,21R,23S)-8-(2-diethoxyphosphorylethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,21R,23S)-8-(2-diethoxyphosphorylethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 100980531 |
| Molecular Formula | C28H46NO11P |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | (1R,15S,16R,21R,23S)-8-(2-diethoxyphosphorylethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | CCOP(=O)(CCN1CCOCCO[C@@H]2[C@@H](OCCOCC1)[C@@H](OC)O[C@@H]1COC(c3ccccc3)O[C@@H]21)OCC |
| InChI | InChI=1S/C28H46NO11P/c1-4-37-41(30,38-5-2)20-13-29-11-14-32-16-18-34-25-24-23(21-36-27(40-24)22-9-7-6-8-10-22)39-28(31-3)26(25)35-19-17-33-15-12-29/h6-10,23-28H,4-5,11-21H2,1-3H3/t23-,24-,25+,26-,27?,28+/m1/s1 |
| InChIKey | HNQDQLJRWICSKR-GUONBBAESA-N |
| XLogP | 2.86 |
| TPSA | 112.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|