C27H44NO11P — CID 100980533
(1R,15S,16R,21R,23S)-8-(diethoxyphosphorylmethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 100980533) has the molecular formula C27H44NO11P and a molecular weight of 589.62 g/mol. Its IUPAC name is (1R,15S,16R,21R,23S)-8-(diethoxyphosphorylmethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,21R,23S)-8-(diethoxyphosphorylmethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 100980533 |
| Molecular Formula | C27H44NO11P |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | (1R,15S,16R,21R,23S)-8-(diethoxyphosphorylmethyl)-23-methoxy-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | CCOP(=O)(CN1CCOCCO[C@@H]2[C@@H](OCCOCC1)[C@@H](OC)O[C@@H]1COC(c3ccccc3)O[C@@H]21)OCC |
| InChI | InChI=1S/C27H44NO11P/c1-4-36-40(29,37-5-2)20-28-11-13-31-15-17-33-24-23-22(19-35-26(39-23)21-9-7-6-8-10-21)38-27(30-3)25(24)34-18-16-32-14-12-28/h6-10,22-27H,4-5,11-20H2,1-3H3/t22-,23-,24+,25-,26?,27+/m1/s1 |
| InChIKey | ZQUSBVAYPHRGKP-FFKPJQCGSA-N |
| XLogP | 2.81 |
| TPSA | 112.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|